C29H35ClNO14P — CID 70582857
[(8S,10S)-8-acetyl-10-(4-amino-5-hydroxy-6-methyloxan-2-yl)oxy-6,8,11-trihydroxy-5,12-dioxo-9,10-dihydro-7H-tetracen-1-yl]oxymethyl dimethyl phosphate;hydrochloride (PubChem CID 70582857) has the molecular formula C29H35ClNO14P and a molecular weight of 688.02 g/mol. Its IUPAC name is [(8S,10S)-8-acetyl-10-(4-amino-5-hydroxy-6-methyloxan-2-yl)oxy-6,8,11-trihydroxy-5,12-dioxo-9,10-dihydro-7H-tetracen-1-yl]oxymethyl dimethyl phosphate;hydrochloride.
| Compound Name | [(8S,10S)-8-acetyl-10-(4-amino-5-hydroxy-6-methyloxan-2-yl)oxy-6,8,11-trihydroxy-5,12-dioxo-9,10-dihydro-7H-tetracen-1-yl]oxymethyl dimethyl phosphate;hydrochloride |
|---|---|
| PubChem CID | 70582857 |
| Molecular Formula | C29H35ClNO14P |
| Molecular Weight | 688.02 g/mol |
| Exact Mass | 687.15 |
| IUPAC Name | [(8S,10S)-8-acetyl-10-(4-amino-5-hydroxy-6-methyloxan-2-yl)oxy-6,8,11-trihydroxy-5,12-dioxo-9,10-dihydro-7H-tetracen-1-yl]oxymethyl dimethyl phosphate;hydrochloride |
| SMILES | COP(=O)(OC)OCOc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(C)=O)C[C@@H]3OC1CC(N)C(O)C(C)O1.Cl |
| InChI | InChI=1S/C29H34NO14P.ClH/c1-12-24(32)16(30)8-19(43-12)44-18-10-29(37,13(2)31)9-15-21(18)28(36)23-22(26(15)34)25(33)14-6-5-7-17(20(14)27(23)35)41-11-42-45(38,39-3)40-4;/h5-7,12,16,18-19,24,32,34,36-37H,8-11,30H2,1-4H3;1H/t12?,16?,18-,19?,24?,29-;/m0./s1 |
| InChIKey | LZLKUVJCUMAKGR-MUUKTGSOSA-N |
| XLogP | 2.20 |
| TPSA | 230.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.02 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|