C43H43NO14 — CID 70595347
[(8S,10S)-8-acetyl-10-(4-amino-5-hydroxy-6-methyloxan-2-yl)oxy-6,8,11-trihydroxy-5,12-dioxo-9,10-dihydro-7H-tetracen-1-yl]oxymethyl 2,2-bis(4-methylphenoxy)acetate (PubChem CID 70595347) has the molecular formula C43H43NO14 and a molecular weight of 797.81 g/mol. Its IUPAC name is [(8S,10S)-8-acetyl-10-(4-amino-5-hydroxy-6-methyloxan-2-yl)oxy-6,8,11-trihydroxy-5,12-dioxo-9,10-dihydro-7H-tetracen-1-yl]oxymethyl 2,2-bis(4-methylphenoxy)acetate.
| Compound Name | [(8S,10S)-8-acetyl-10-(4-amino-5-hydroxy-6-methyloxan-2-yl)oxy-6,8,11-trihydroxy-5,12-dioxo-9,10-dihydro-7H-tetracen-1-yl]oxymethyl 2,2-bis(4-methylphenoxy)acetate |
|---|---|
| PubChem CID | 70595347 |
| Molecular Formula | C43H43NO14 |
| Molecular Weight | 797.81 g/mol |
| Exact Mass | 797.27 |
| IUPAC Name | [(8S,10S)-8-acetyl-10-(4-amino-5-hydroxy-6-methyloxan-2-yl)oxy-6,8,11-trihydroxy-5,12-dioxo-9,10-dihydro-7H-tetracen-1-yl]oxymethyl 2,2-bis(4-methylphenoxy)acetate |
| SMILES | CC(=O)[C@]1(O)Cc2c(O)c3c(c(O)c2[C@@H](OC2CC(N)C(O)C(C)O2)C1)C(=O)c1c(OCOC(=O)C(Oc2ccc(C)cc2)Oc2ccc(C)cc2)cccc1C3=O |
| InChI | InChI=1S/C43H43NO14/c1-20-8-12-24(13-9-20)56-42(57-25-14-10-21(2)11-15-25)41(51)54-19-53-29-7-5-6-26-32(29)39(49)35-34(37(26)47)38(48)27-17-43(52,23(4)45)18-30(33(27)40(35)50)58-31-16-28(44)36(46)22(3)55-31/h5-15,22,28,30-31,36,42,46,48,50,52H,16-19,44H2,1-4H3/t22?,28?,30-,31?,36?,43-/m0/s1 |
| InChIKey | UHWXHOXUGWBTBB-KKKDBWOJSA-N |
| XLogP | 4.00 |
| TPSA | 230.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.81 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|