C33H40ClNO14 — CID 70594742
[(8S,10S)-8-acetyl-10-(4-amino-5-hydroxy-6-methyloxan-2-yl)oxy-6,8,11-trihydroxy-5,12-dioxo-9,10-dihydro-7H-tetracen-1-yl]oxymethyl 2,2-diethoxyacetate;hydrochloride (PubChem CID 70594742) has the molecular formula C33H40ClNO14 and a molecular weight of 710.13 g/mol. Its IUPAC name is [(8S,10S)-8-acetyl-10-(4-amino-5-hydroxy-6-methyloxan-2-yl)oxy-6,8,11-trihydroxy-5,12-dioxo-9,10-dihydro-7H-tetracen-1-yl]oxymethyl 2,2-diethoxyacetate;hydrochloride.
| Compound Name | [(8S,10S)-8-acetyl-10-(4-amino-5-hydroxy-6-methyloxan-2-yl)oxy-6,8,11-trihydroxy-5,12-dioxo-9,10-dihydro-7H-tetracen-1-yl]oxymethyl 2,2-diethoxyacetate;hydrochloride |
|---|---|
| PubChem CID | 70594742 |
| Molecular Formula | C33H40ClNO14 |
| Molecular Weight | 710.13 g/mol |
| Exact Mass | 709.21 |
| IUPAC Name | [(8S,10S)-8-acetyl-10-(4-amino-5-hydroxy-6-methyloxan-2-yl)oxy-6,8,11-trihydroxy-5,12-dioxo-9,10-dihydro-7H-tetracen-1-yl]oxymethyl 2,2-diethoxyacetate;hydrochloride |
| SMILES | CCOC(OCC)C(=O)OCOc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(C)=O)C[C@@H]3OC1CC(N)C(O)C(C)O1.Cl |
| InChI | InChI=1S/C33H39NO14.ClH/c1-5-43-32(44-6-2)31(41)46-13-45-19-9-7-8-16-22(19)29(39)25-24(27(16)37)28(38)17-11-33(42,15(4)35)12-20(23(17)30(25)40)48-21-10-18(34)26(36)14(3)47-21;/h7-9,14,18,20-21,26,32,36,38,40,42H,5-6,10-13,34H2,1-4H3;1H/t14?,18?,20-,21?,26?,33-;/m0./s1 |
| InChIKey | AUUCFFZLBHQKBI-BOGJKYRYSA-N |
| XLogP | 1.72 |
| TPSA | 230.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.13 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|