C30H30F3NO12 — CID 88792265
N-[6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-10-(methoxymethoxy)-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]-2,2,2-trifluoroacetamide (PubChem CID 88792265) has the molecular formula C30H30F3NO12 and a molecular weight of 653.56 g/mol. Its IUPAC name is N-[6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-10-(methoxymethoxy)-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-10-(methoxymethoxy)-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 88792265 |
| Molecular Formula | C30H30F3NO12 |
| Molecular Weight | 653.56 g/mol |
| Exact Mass | 653.17 |
| IUPAC Name | N-[6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-10-(methoxymethoxy)-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]-2,2,2-trifluoroacetamide |
| SMILES | COCOc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(C)=O)C[C@@H]3OC1CC(NC(=O)C(F)(F)F)C(O)C(C)O1 |
| InChI | InChI=1S/C30H30F3NO12/c1-11-23(36)15(34-28(41)30(31,32)33)7-18(45-11)46-17-9-29(42,12(2)35)8-14-20(17)27(40)22-21(25(14)38)24(37)13-5-4-6-16(44-10-43-3)19(13)26(22)39/h4-6,11,15,17-18,23,36,38,40,42H,7-10H2,1-3H3,(H,34,41)/t11?,15?,17-,18?,23?,29-/m0/s1 |
| InChIKey | SKBDUGLPHMBAIZ-KUPVYAPOSA-N |
| XLogP | 1.72 |
| TPSA | 198.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.56 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|