C30H35N3O11 — CID 56987792
N-[6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]-3,3-diaminopropanamide (PubChem CID 56987792) has the molecular formula C30H35N3O11 and a molecular weight of 613.62 g/mol. Its IUPAC name is N-[6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]-3,3-diaminopropanamide.
| Compound Name | N-[6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]-3,3-diaminopropanamide |
|---|---|
| PubChem CID | 56987792 |
| Molecular Formula | C30H35N3O11 |
| Molecular Weight | 613.62 g/mol |
| Exact Mass | 613.23 |
| IUPAC Name | N-[6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]-3,3-diaminopropanamide |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(C)=O)C[C@@H]3OC1CC(NC(=O)CC(N)N)C(O)C(C)O1 |
| InChI | InChI=1S/C30H35N3O11/c1-11-25(36)15(33-19(35)8-18(31)32)7-20(43-11)44-17-10-30(41,12(2)34)9-14-22(17)29(40)24-23(27(14)38)26(37)13-5-4-6-16(42-3)21(13)28(24)39/h4-6,11,15,17-18,20,25,36,38,40-41H,7-10,31-32H2,1-3H3,(H,33,35)/t11?,15?,17-,20?,25?,30-/m0/s1 |
| InChIKey | USZWYYBXKPDIDW-BFFSWZGGSA-N |
| XLogP | -0.18 |
| TPSA | 240.96 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.62 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|