C30H32ArNO14S- — CID 159739300
2-[[6-[[(3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]carbamoyloxy]ethanesulfinate;argon (PubChem CID 159739300) has the molecular formula C30H32ArNO14S- and a molecular weight of 702.59 g/mol. Its IUPAC name is 2-[[6-[[(3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]carbamoyloxy]ethanesulfinate;argon.
| Compound Name | 2-[[6-[[(3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]carbamoyloxy]ethanesulfinate;argon |
|---|---|
| PubChem CID | 159739300 |
| Molecular Formula | C30H32ArNO14S- |
| Molecular Weight | 702.59 g/mol |
| Exact Mass | 702.12 |
| IUPAC Name | 2-[[6-[[(3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]carbamoyloxy]ethanesulfinate;argon |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(C)=O)CC3OC1CC(NC(=O)OCCS(=O)[O-])C(O)C(C)O1.[Ar] |
| InChI | InChI=1S/C30H33NO14S.Ar/c1-12-24(33)16(31-29(38)43-7-8-46(40)41)9-19(44-12)45-18-11-30(39,13(2)32)10-15-21(18)28(37)23-22(26(15)35)25(34)14-5-4-6-17(42-3)20(14)27(23)36;/h4-6,12,16,18-19,24,33,35,37,39H,7-11H2,1-3H3,(H,31,38)(H,40,41);/p-1/t12?,16?,18?,19?,24?,30-;/m0./s1 |
| InChIKey | VDDXXKAODCKOOF-SIABPPCGSA-M |
| XLogP | 0.68 |
| TPSA | 238.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.59 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|