C34H34N2O12 — CID 69440697
1-[6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]-3-(4-hydroxyphenyl)urea (PubChem CID 69440697) has the molecular formula C34H34N2O12 and a molecular weight of 662.65 g/mol. Its IUPAC name is 1-[6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]-3-(4-hydroxyphenyl)urea.
| Compound Name | 1-[6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]-3-(4-hydroxyphenyl)urea |
|---|---|
| PubChem CID | 69440697 |
| Molecular Formula | C34H34N2O12 |
| Molecular Weight | 662.65 g/mol |
| Exact Mass | 662.21 |
| IUPAC Name | 1-[6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]-3-(4-hydroxyphenyl)urea |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(C)=O)C[C@@H]3OC1CC(NC(=O)Nc2ccc(O)cc2)C(O)C(C)O1 |
| InChI | InChI=1S/C34H34N2O12/c1-14-28(39)20(36-33(44)35-16-7-9-17(38)10-8-16)11-23(47-14)48-22-13-34(45,15(2)37)12-19-25(22)32(43)27-26(30(19)41)29(40)18-5-4-6-21(46-3)24(18)31(27)42/h4-10,14,20,22-23,28,38-39,41,43,45H,11-13H2,1-3H3,(H2,35,36,44)/t14?,20?,22-,23?,28?,34-/m0/s1 |
| InChIKey | SXVSIRWESZREPH-UUEGAZBASA-N |
| XLogP | 2.60 |
| TPSA | 221.18 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.65 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|