C30H35NO11 — CID 70193024
(7S,9S)-9-acetyl-6,9,11-trihydroxy-7-[5-hydroxy-4-(3-hydroxypropylamino)-6-methyloxan-2-yl]oxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 70193024) has the molecular formula C30H35NO11 and a molecular weight of 585.61 g/mol. Its IUPAC name is (7S,9S)-9-acetyl-6,9,11-trihydroxy-7-[5-hydroxy-4-(3-hydroxypropylamino)-6-methyloxan-2-yl]oxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (7S,9S)-9-acetyl-6,9,11-trihydroxy-7-[5-hydroxy-4-(3-hydroxypropylamino)-6-methyloxan-2-yl]oxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 70193024 |
| Molecular Formula | C30H35NO11 |
| Molecular Weight | 585.61 g/mol |
| Exact Mass | 585.22 |
| IUPAC Name | (7S,9S)-9-acetyl-6,9,11-trihydroxy-7-[5-hydroxy-4-(3-hydroxypropylamino)-6-methyloxan-2-yl]oxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(C)=O)C[C@@H]3OC1CC(NCCCO)C(O)C(C)O1 |
| InChI | InChI=1S/C30H35NO11/c1-13-25(34)17(31-8-5-9-32)10-20(41-13)42-19-12-30(39,14(2)33)11-16-22(19)29(38)24-23(27(16)36)26(35)15-6-4-7-18(40-3)21(15)28(24)37/h4,6-7,13,17,19-20,25,31-32,34,36,38-39H,5,8-12H2,1-3H3/t13?,17?,19-,20?,25?,30-/m0/s1 |
| InChIKey | HVHQWGNNDVFACM-UGXNQGSGSA-N |
| XLogP | 1.04 |
| TPSA | 192.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.61 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|