C31H35NO12 — CID 155801988
methyl 3-[[(2S,3S,4S,6R)-6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]amino]propanoate (PubChem CID 155801988) has the molecular formula C31H35NO12 and a molecular weight of 613.62 g/mol. Its IUPAC name is methyl 3-[[(2S,3S,4S,6R)-6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]amino]propanoate.
| Compound Name | methyl 3-[[(2S,3S,4S,6R)-6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]amino]propanoate |
|---|---|
| PubChem CID | 155801988 |
| Molecular Formula | C31H35NO12 |
| Molecular Weight | 613.62 g/mol |
| Exact Mass | 613.22 |
| IUPAC Name | methyl 3-[[(2S,3S,4S,6R)-6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]amino]propanoate |
| SMILES | COC(=O)CCN[C@H]1C[C@H](O[C@H]2C[C@](O)(C(C)=O)Cc3c(O)c4c(c(O)c32)C(=O)c2c(OC)cccc2C4=O)O[C@@H](C)[C@H]1O |
| InChI | InChI=1S/C31H35NO12/c1-13-26(35)17(32-9-8-20(34)42-4)10-21(43-13)44-19-12-31(40,14(2)33)11-16-23(19)30(39)25-24(28(16)37)27(36)15-6-5-7-18(41-3)22(15)29(25)38/h5-7,13,17,19,21,26,32,35,37,39-40H,8-12H2,1-4H3/t13-,17-,19-,21-,26+,31-/m0/s1 |
| InChIKey | DJVMZFNIWHLMJN-WFIXBFCKSA-N |
| XLogP | 1.22 |
| TPSA | 198.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.62 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|