C28H30N2O11 — CID 14525922
1-[(2S,3S,4S,6R)-6-[[(1S,3S)-3-acetyl-3,5,10,12-tetrahydroxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]-3-methylurea (PubChem CID 14525922) has the molecular formula C28H30N2O11 and a molecular weight of 570.55 g/mol. Its IUPAC name is 1-[(2S,3S,4S,6R)-6-[[(1S,3S)-3-acetyl-3,5,10,12-tetrahydroxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]-3-methylurea.
| Compound Name | 1-[(2S,3S,4S,6R)-6-[[(1S,3S)-3-acetyl-3,5,10,12-tetrahydroxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]-3-methylurea |
|---|---|
| PubChem CID | 14525922 |
| Molecular Formula | C28H30N2O11 |
| Molecular Weight | 570.55 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | 1-[(2S,3S,4S,6R)-6-[[(1S,3S)-3-acetyl-3,5,10,12-tetrahydroxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]-3-methylurea |
| SMILES | CNC(=O)N[C@H]1C[C@H](O[C@H]2C[C@](O)(C(C)=O)Cc3c(O)c4c(c(O)c32)C(=O)c2c(O)cccc2C4=O)O[C@@H](C)[C@H]1O |
| InChI | InChI=1S/C28H30N2O11/c1-10-22(33)14(30-27(38)29-3)7-17(40-10)41-16-9-28(39,11(2)31)8-13-19(16)26(37)21-20(24(13)35)23(34)12-5-4-6-15(32)18(12)25(21)36/h4-6,10,14,16-17,22,32-33,35,37,39H,7-9H2,1-3H3,(H2,29,30,38)/t10-,14-,16-,17-,22+,28-/m0/s1 |
| InChIKey | GIQVSLQCSVTRLY-HWJSKKJZSA-N |
| XLogP | 0.70 |
| TPSA | 211.95 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.55 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|