C31H30F3NO12 — CID 165366127
[(2S,3R,4S,6R)-6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-2-methyl-3-[(2,2,2-trifluoroacetyl)amino]oxan-4-yl] acetate (PubChem CID 165366127) has the molecular formula C31H30F3NO12 and a molecular weight of 665.57 g/mol. Its IUPAC name is [(2S,3R,4S,6R)-6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-2-methyl-3-[(2,2,2-trifluoroacetyl)amino]oxan-4-yl] acetate.
| Compound Name | [(2S,3R,4S,6R)-6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-2-methyl-3-[(2,2,2-trifluoroacetyl)amino]oxan-4-yl] acetate |
|---|---|
| PubChem CID | 165366127 |
| Molecular Formula | C31H30F3NO12 |
| Molecular Weight | 665.57 g/mol |
| Exact Mass | 665.17 |
| IUPAC Name | [(2S,3R,4S,6R)-6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-2-methyl-3-[(2,2,2-trifluoroacetyl)amino]oxan-4-yl] acetate |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(C)=O)C[C@@H]3O[C@H]1C[C@H](OC(C)=O)[C@H](NC(=O)C(F)(F)F)[C@H](C)O1 |
| InChI | InChI=1S/C31H30F3NO12/c1-11-24(35-29(42)31(32,33)34)17(46-13(3)37)8-19(45-11)47-18-10-30(43,12(2)36)9-15-21(18)28(41)23-22(26(15)39)25(38)14-6-5-7-16(44-4)20(14)27(23)40/h5-7,11,17-19,24,39,41,43H,8-10H2,1-4H3,(H,35,42)/t11-,17-,18-,19-,24+,30-/m0/s1 |
| InChIKey | XVWQWPOTOGBJEV-LMEGRLCNSA-N |
| XLogP | 2.32 |
| TPSA | 194.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.57 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|