C30H28F3NO11 — CID 165429105
[(2S,3S,4S,6R)-6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-2-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate (PubChem CID 165429105) has the molecular formula C30H28F3NO11 and a molecular weight of 635.54 g/mol. Its IUPAC name is [(2S,3S,4S,6R)-6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-2-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate.
| Compound Name | [(2S,3S,4S,6R)-6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-2-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 165429105 |
| Molecular Formula | C30H28F3NO11 |
| Molecular Weight | 635.54 g/mol |
| Exact Mass | 635.16 |
| IUPAC Name | [(2S,3S,4S,6R)-6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-2-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](NC(=O)C(F)(F)F)C[C@H](O[C@H]2C[C@](O)(C(C)=O)Cc3c(O)c4c(c(O)c32)C(=O)c2ccccc2C4=O)O[C@H]1C |
| InChI | InChI=1S/C30H28F3NO11/c1-11-27(44-13(3)36)17(34-28(41)30(31,32)33)8-19(43-11)45-18-10-29(42,12(2)35)9-16-20(18)26(40)22-21(25(16)39)23(37)14-6-4-5-7-15(14)24(22)38/h4-7,11,17-19,27,39-40,42H,8-10H2,1-3H3,(H,34,41)/t11-,17-,18-,19-,27+,29-/m0/s1 |
| InChIKey | MINSFGRGXKOGFP-UGXLXMJVSA-N |
| XLogP | 2.31 |
| TPSA | 185.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.54 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|