C28H28F3NO9 — CID 88679176
N-[(2R,3R,4S,6R)-6-[[(1S)-3-ethyl-3,5,12-trihydroxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]-2,2,2-trifluoroacetamide (PubChem CID 88679176) has the molecular formula C28H28F3NO9 and a molecular weight of 579.52 g/mol. Its IUPAC name is N-[(2R,3R,4S,6R)-6-[[(1S)-3-ethyl-3,5,12-trihydroxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2R,3R,4S,6R)-6-[[(1S)-3-ethyl-3,5,12-trihydroxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 88679176 |
| Molecular Formula | C28H28F3NO9 |
| Molecular Weight | 579.52 g/mol |
| Exact Mass | 579.17 |
| IUPAC Name | N-[(2R,3R,4S,6R)-6-[[(1S)-3-ethyl-3,5,12-trihydroxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]-2,2,2-trifluoroacetamide |
| SMILES | CCC1(O)Cc2c(O)c3c(c(O)c2[C@@H](O[C@H]2C[C@H](NC(=O)C(F)(F)F)[C@@H](O)[C@@H](C)O2)C1)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C28H28F3NO9/c1-3-27(39)9-14-18(25(37)20-19(24(14)36)22(34)12-6-4-5-7-13(12)23(20)35)16(10-27)41-17-8-15(21(33)11(2)40-17)32-26(38)28(29,30)31/h4-7,11,15-17,21,33,36-37,39H,3,8-10H2,1-2H3,(H,32,38)/t11-,15+,16+,17+,21+,27?/m1/s1 |
| InChIKey | MPLFYXGKLCPCKG-OQSXHXAZSA-N |
| XLogP | 2.56 |
| TPSA | 162.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.52 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|