C31H32F3NO11 — CID 88695511
2-[(4S)-2,5,12-trihydroxy-4-[(2R,4S,5R,6R)-5-methoxy-6-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]oxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]ethyl acetate (PubChem CID 88695511) has the molecular formula C31H32F3NO11 and a molecular weight of 651.59 g/mol. Its IUPAC name is 2-[(4S)-2,5,12-trihydroxy-4-[(2R,4S,5R,6R)-5-methoxy-6-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]oxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]ethyl acetate.
| Compound Name | 2-[(4S)-2,5,12-trihydroxy-4-[(2R,4S,5R,6R)-5-methoxy-6-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]oxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]ethyl acetate |
|---|---|
| PubChem CID | 88695511 |
| Molecular Formula | C31H32F3NO11 |
| Molecular Weight | 651.59 g/mol |
| Exact Mass | 651.19 |
| IUPAC Name | 2-[(4S)-2,5,12-trihydroxy-4-[(2R,4S,5R,6R)-5-methoxy-6-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]oxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]ethyl acetate |
| SMILES | CO[C@@H]1[C@@H](NC(=O)C(F)(F)F)C[C@H](O[C@H]2CC(O)(CCOC(C)=O)Cc3c(O)c4c(c(O)c32)C(=O)c2ccccc2C4=O)O[C@@H]1C |
| InChI | InChI=1S/C31H32F3NO11/c1-13-28(43-3)18(35-29(41)31(32,33)34)10-20(45-13)46-19-12-30(42,8-9-44-14(2)36)11-17-21(19)27(40)23-22(26(17)39)24(37)15-6-4-5-7-16(15)25(23)38/h4-7,13,18-20,28,39-40,42H,8-12H2,1-3H3,(H,35,41)/t13-,18+,19+,20+,28+,30?/m1/s1 |
| InChIKey | TWQALFHMNQKFMJ-JCJALVOASA-N |
| XLogP | 2.76 |
| TPSA | 177.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.59 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|