C31H34N2O11 — CID 57243111
(7S,9S)-9-acetyl-6,9,11-trihydroxy-7-[4-(hydroxyamino)-6-methyl-5-oxooxan-2-yl]oxy-4-(pyrrolidin-1-ylmethoxy)-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 57243111) has the molecular formula C31H34N2O11 and a molecular weight of 610.62 g/mol. Its IUPAC name is (7S,9S)-9-acetyl-6,9,11-trihydroxy-7-[4-(hydroxyamino)-6-methyl-5-oxooxan-2-yl]oxy-4-(pyrrolidin-1-ylmethoxy)-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (7S,9S)-9-acetyl-6,9,11-trihydroxy-7-[4-(hydroxyamino)-6-methyl-5-oxooxan-2-yl]oxy-4-(pyrrolidin-1-ylmethoxy)-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 57243111 |
| Molecular Formula | C31H34N2O11 |
| Molecular Weight | 610.62 g/mol |
| Exact Mass | 610.22 |
| IUPAC Name | (7S,9S)-9-acetyl-6,9,11-trihydroxy-7-[4-(hydroxyamino)-6-methyl-5-oxooxan-2-yl]oxy-4-(pyrrolidin-1-ylmethoxy)-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | CC(=O)[C@]1(O)Cc2c(O)c3c(c(O)c2[C@@H](OC2CC(NO)C(=O)C(C)O2)C1)C(=O)c1c(OCN2CCCC2)cccc1C3=O |
| InChI | InChI=1S/C31H34N2O11/c1-14-26(35)18(32-41)10-21(43-14)44-20-12-31(40,15(2)34)11-17-23(20)30(39)25-24(28(17)37)27(36)16-6-5-7-19(22(16)29(25)38)42-13-33-8-3-4-9-33/h5-7,14,18,20-21,32,37,39-41H,3-4,8-13H2,1-2H3/t14?,18?,20-,21?,31-/m0/s1 |
| InChIKey | AZEQANXIDPCZBG-UWZDODKYSA-N |
| XLogP | 1.68 |
| TPSA | 192.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.62 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|