C34H34O11 — CID 158553411
(7R,9S)-9-acetyl-6,9,11-trihydroxy-7-(4-hydroxy-6-methyl-5-phenylmethoxyoxan-2-yl)oxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 158553411) has the molecular formula C34H34O11 and a molecular weight of 618.64 g/mol. Its IUPAC name is (7R,9S)-9-acetyl-6,9,11-trihydroxy-7-(4-hydroxy-6-methyl-5-phenylmethoxyoxan-2-yl)oxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (7R,9S)-9-acetyl-6,9,11-trihydroxy-7-(4-hydroxy-6-methyl-5-phenylmethoxyoxan-2-yl)oxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 158553411 |
| Molecular Formula | C34H34O11 |
| Molecular Weight | 618.64 g/mol |
| Exact Mass | 618.21 |
| IUPAC Name | (7R,9S)-9-acetyl-6,9,11-trihydroxy-7-(4-hydroxy-6-methyl-5-phenylmethoxyoxan-2-yl)oxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(C)=O)C[C@H]3OC1CC(O)C(OCc2ccccc2)C(C)O1 |
| InChI | InChI=1S/C34H34O11/c1-16-33(43-15-18-8-5-4-6-9-18)21(36)12-24(44-16)45-23-14-34(41,17(2)35)13-20-26(23)32(40)28-27(30(20)38)29(37)19-10-7-11-22(42-3)25(19)31(28)39/h4-11,16,21,23-24,33,36,38,40-41H,12-15H2,1-3H3/t16?,21?,23-,24?,33?,34+/m1/s1 |
| InChIKey | IOBSYKJJMRVODN-YQFCIQGISA-N |
| XLogP | 3.29 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.64 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|