C33H32O10 — CID 59913092
(7R)-9-acetyl-6,9,11-trihydroxy-7-(4-hydroxy-6-methyl-5-phenylmethoxyoxan-2-yl)oxy-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 59913092) has the molecular formula C33H32O10 and a molecular weight of 588.61 g/mol. Its IUPAC name is (7R)-9-acetyl-6,9,11-trihydroxy-7-(4-hydroxy-6-methyl-5-phenylmethoxyoxan-2-yl)oxy-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (7R)-9-acetyl-6,9,11-trihydroxy-7-(4-hydroxy-6-methyl-5-phenylmethoxyoxan-2-yl)oxy-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 59913092 |
| Molecular Formula | C33H32O10 |
| Molecular Weight | 588.61 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | (7R)-9-acetyl-6,9,11-trihydroxy-7-(4-hydroxy-6-methyl-5-phenylmethoxyoxan-2-yl)oxy-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | CC(=O)C1(O)Cc2c(O)c3c(c(O)c2[C@H](OC2CC(O)C(OCc4ccccc4)C(C)O2)C1)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C33H32O10/c1-16-32(41-15-18-8-4-3-5-9-18)22(35)12-24(42-16)43-23-14-33(40,17(2)34)13-21-25(23)31(39)27-26(30(21)38)28(36)19-10-6-7-11-20(19)29(27)37/h3-11,16,22-24,32,35,38-40H,12-15H2,1-2H3/t16?,22?,23-,24?,32?,33?/m1/s1 |
| InChIKey | GDLIUSZHFSRRIB-YTINJJHMSA-N |
| XLogP | 3.28 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.61 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|