C33H32FNO9 — CID 24786187
(7S,9S)-9-acetyl-7-[4-amino-5-[(4-fluorophenyl)methoxy]-6-methyloxan-2-yl]oxy-6,9,11-trihydroxy-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 24786187) has the molecular formula C33H32FNO9 and a molecular weight of 605.62 g/mol. Its IUPAC name is (7S,9S)-9-acetyl-7-[4-amino-5-[(4-fluorophenyl)methoxy]-6-methyloxan-2-yl]oxy-6,9,11-trihydroxy-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (7S,9S)-9-acetyl-7-[4-amino-5-[(4-fluorophenyl)methoxy]-6-methyloxan-2-yl]oxy-6,9,11-trihydroxy-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 24786187 |
| Molecular Formula | C33H32FNO9 |
| Molecular Weight | 605.62 g/mol |
| Exact Mass | 605.21 |
| IUPAC Name | (7S,9S)-9-acetyl-7-[4-amino-5-[(4-fluorophenyl)methoxy]-6-methyloxan-2-yl]oxy-6,9,11-trihydroxy-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | CC(=O)[C@]1(O)Cc2c(O)c3c(c(O)c2[C@@H](OC2CC(N)C(OCc4ccc(F)cc4)C(C)O2)C1)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C33H32FNO9/c1-15-32(42-14-17-7-9-18(34)10-8-17)22(35)11-24(43-15)44-23-13-33(41,16(2)36)12-21-25(23)31(40)27-26(30(21)39)28(37)19-5-3-4-6-20(19)29(27)38/h3-10,15,22-24,32,39-41H,11-14,35H2,1-2H3/t15?,22?,23-,24?,32?,33-/m0/s1 |
| InChIKey | PGLLQBKXSHHISZ-UYMQUTLSSA-N |
| XLogP | 3.38 |
| TPSA | 165.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.62 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|