C31H33NO10 — CID 59037507
(7S,9S)-9-acetyl-6,9,11-trihydroxy-4-methoxy-7-[(12-methyl-7,11-dioxa-2-azatricyclo[6.4.0.02,6]dodecan-10-yl)oxy]-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 59037507) has the molecular formula C31H33NO10 and a molecular weight of 579.60 g/mol. Its IUPAC name is (7S,9S)-9-acetyl-6,9,11-trihydroxy-4-methoxy-7-[(12-methyl-7,11-dioxa-2-azatricyclo[6.4.0.02,6]dodecan-10-yl)oxy]-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (7S,9S)-9-acetyl-6,9,11-trihydroxy-4-methoxy-7-[(12-methyl-7,11-dioxa-2-azatricyclo[6.4.0.02,6]dodecan-10-yl)oxy]-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 59037507 |
| Molecular Formula | C31H33NO10 |
| Molecular Weight | 579.60 g/mol |
| Exact Mass | 579.21 |
| IUPAC Name | (7S,9S)-9-acetyl-6,9,11-trihydroxy-4-methoxy-7-[(12-methyl-7,11-dioxa-2-azatricyclo[6.4.0.02,6]dodecan-10-yl)oxy]-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(C)=O)C[C@@H]3OC1CC2OC3CCCN3C2C(C)O1 |
| InChI | InChI=1S/C31H33NO10/c1-13-26-18(41-20-8-5-9-32(20)26)10-21(40-13)42-19-12-31(38,14(2)33)11-16-23(19)30(37)25-24(28(16)35)27(34)15-6-4-7-17(39-3)22(15)29(25)36/h4,6-7,13,18-21,26,35,37-38H,5,8-12H2,1-3H3/t13?,18?,19-,20?,21?,26?,31-/m0/s1 |
| InChIKey | RGKCALZOOQNDHI-MTRRPYIOSA-N |
| XLogP | 2.53 |
| TPSA | 152.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.60 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|