C19H16O6 — CID 102430460
(1S,3S)-1,5,8,11-tetrahydroxy-3-methyl-1,2,3,4-tetrahydrobenzo[a]anthracene-7,12-dione (PubChem CID 102430460) has the molecular formula C19H16O6 and a molecular weight of 340.33 g/mol. Its IUPAC name is (1S,3S)-1,5,8,11-tetrahydroxy-3-methyl-1,2,3,4-tetrahydrobenzo[a]anthracene-7,12-dione.
| Compound Name | (1S,3S)-1,5,8,11-tetrahydroxy-3-methyl-1,2,3,4-tetrahydrobenzo[a]anthracene-7,12-dione |
|---|---|
| PubChem CID | 102430460 |
| Molecular Formula | C19H16O6 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | (1S,3S)-1,5,8,11-tetrahydroxy-3-methyl-1,2,3,4-tetrahydrobenzo[a]anthracene-7,12-dione |
| SMILES | C[C@H]1Cc2c(O)cc3c(c2[C@@H](O)C1)C(=O)c1c(O)ccc(O)c1C3=O |
| InChI | InChI=1S/C19H16O6/c1-7-4-8-12(22)6-9-15(14(8)13(23)5-7)19(25)17-11(21)3-2-10(20)16(17)18(9)24/h2-3,6-7,13,20-23H,4-5H2,1H3/t7-,13-/m0/s1 |
| InChIKey | NXMMIDHKNNDZHM-CPFSXVBKSA-N |
| XLogP | 2.19 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|