C26H29NO10 — CID 10324211
(7S,9R,10R)-10-[(2S,4S,5S,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-9-ethyl-1,4,7,9,11-pentahydroxy-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 10324211) has the molecular formula C26H29NO10 and a molecular weight of 515.52 g/mol. Its IUPAC name is (7S,9R,10R)-10-[(2S,4S,5S,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-9-ethyl-1,4,7,9,11-pentahydroxy-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (7S,9R,10R)-10-[(2S,4S,5S,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-9-ethyl-1,4,7,9,11-pentahydroxy-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 10324211 |
| Molecular Formula | C26H29NO10 |
| Molecular Weight | 515.52 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | (7S,9R,10R)-10-[(2S,4S,5S,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-9-ethyl-1,4,7,9,11-pentahydroxy-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | CC[C@@]1(O)C[C@H](O)c2cc3c(c(O)c2[C@H]1O[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1)C(=O)c1c(O)ccc(O)c1C3=O |
| InChI | InChI=1S/C26H29NO10/c1-3-26(35)8-15(30)10-6-11-17(24(34)20-14(29)5-4-13(28)19(20)22(11)32)23(33)18(10)25(26)37-16-7-12(27)21(31)9(2)36-16/h4-6,9,12,15-16,21,25,28-31,33,35H,3,7-8,27H2,1-2H3/t9-,12-,15-,16-,21+,25+,26+/m0/s1 |
| InChIKey | SLBQVAOYTLXPEJ-GQKZXETDSA-N |
| XLogP | 1.04 |
| TPSA | 200.00 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.52 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|