C26H29NO9 — CID 162845469
7-(4-amino-5-hydroxy-6-methyloxan-2-yl)oxy-9-ethyl-1,4,6,9-tetrahydroxy-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 162845469) has the molecular formula C26H29NO9 and a molecular weight of 499.52 g/mol. Its IUPAC name is 7-(4-amino-5-hydroxy-6-methyloxan-2-yl)oxy-9-ethyl-1,4,6,9-tetrahydroxy-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | 7-(4-amino-5-hydroxy-6-methyloxan-2-yl)oxy-9-ethyl-1,4,6,9-tetrahydroxy-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 162845469 |
| Molecular Formula | C26H29NO9 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | 7-(4-amino-5-hydroxy-6-methyloxan-2-yl)oxy-9-ethyl-1,4,6,9-tetrahydroxy-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | CCC1(O)Cc2cc3c(c(O)c2C(OC2CC(N)C(O)C(C)O2)C1)C(=O)c1c(O)ccc(O)c1C3=O |
| InChI | InChI=1S/C26H29NO9/c1-3-26(34)8-11-6-12-19(25(33)21-15(29)5-4-14(28)20(21)23(12)31)24(32)18(11)16(9-26)36-17-7-13(27)22(30)10(2)35-17/h4-6,10,13,16-17,22,28-30,32,34H,3,7-9,27H2,1-2H3 |
| InChIKey | KGRCSDJARXQFNS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 179.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|