C16H10O6 — CID 139659317
5,8-dihydroxy-4-methoxy-9,10-dioxoanthracene-1-carbaldehyde (PubChem CID 139659317) has the molecular formula C16H10O6 and a molecular weight of 298.25 g/mol. Its IUPAC name is 5,8-dihydroxy-4-methoxy-9,10-dioxoanthracene-1-carbaldehyde.
| Compound Name | 5,8-dihydroxy-4-methoxy-9,10-dioxoanthracene-1-carbaldehyde |
|---|---|
| PubChem CID | 139659317 |
| Molecular Formula | C16H10O6 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 5,8-dihydroxy-4-methoxy-9,10-dioxoanthracene-1-carbaldehyde |
| SMILES | COc1ccc(C=O)c2c1C(=O)c1c(O)ccc(O)c1C2=O |
| InChI | InChI=1S/C16H10O6/c1-22-10-5-2-7(6-17)11-14(10)16(21)13-9(19)4-3-8(18)12(13)15(11)20/h2-6,18-19H,1H3 |
| InChIKey | MGLDMZCHZPFFEA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|