C19H12O6 — CID 70548578
8-hydroxy-11-methoxy-3-methylnaphtho[2,3-c]isochromene-5,7,12-trione (PubChem CID 70548578) has the molecular formula C19H12O6 and a molecular weight of 336.30 g/mol. Its IUPAC name is 8-hydroxy-11-methoxy-3-methylnaphtho[2,3-c]isochromene-5,7,12-trione.
| Compound Name | 8-hydroxy-11-methoxy-3-methylnaphtho[2,3-c]isochromene-5,7,12-trione |
|---|---|
| PubChem CID | 70548578 |
| Molecular Formula | C19H12O6 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 8-hydroxy-11-methoxy-3-methylnaphtho[2,3-c]isochromene-5,7,12-trione |
| SMILES | COc1ccc(O)c2c1C(=O)c1c(oc(=O)c3cc(C)ccc13)C2=O |
| InChI | InChI=1S/C19H12O6/c1-8-3-4-9-10(7-8)19(23)25-18-13(9)16(21)15-12(24-2)6-5-11(20)14(15)17(18)22/h3-7,20H,1-2H3 |
| InChIKey | LOQVOGHRDWBYKD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|