C14H8O5 — CID 10491256
5-methoxy-4,9-dioxobenzo[f][1]benzofuran-8-carbaldehyde (PubChem CID 10491256) has the molecular formula C14H8O5 and a molecular weight of 256.21 g/mol. Its IUPAC name is 5-methoxy-4,9-dioxobenzo[f][1]benzofuran-8-carbaldehyde.
| Compound Name | 5-methoxy-4,9-dioxobenzo[f][1]benzofuran-8-carbaldehyde |
|---|---|
| PubChem CID | 10491256 |
| Molecular Formula | C14H8O5 |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 5-methoxy-4,9-dioxobenzo[f][1]benzofuran-8-carbaldehyde |
| SMILES | COc1ccc(C=O)c2c1C(=O)c1ccoc1C2=O |
| InChI | InChI=1S/C14H8O5/c1-18-9-3-2-7(6-15)10-11(9)12(16)8-4-5-19-14(8)13(10)17/h2-6H,1H3 |
| InChIKey | ZEQKYZUXBDCNQQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|