C17H18O5Si — CID 102374461
5,8-dimethoxy-3-trimethylsilylbenzo[f][2]benzofuran-4,9-dione (PubChem CID 102374461) has the molecular formula C17H18O5Si and a molecular weight of 330.41 g/mol. Its IUPAC name is 5,8-dimethoxy-3-trimethylsilylbenzo[f][2]benzofuran-4,9-dione.
| Compound Name | 5,8-dimethoxy-3-trimethylsilylbenzo[f][2]benzofuran-4,9-dione |
|---|---|
| PubChem CID | 102374461 |
| Molecular Formula | C17H18O5Si |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 5,8-dimethoxy-3-trimethylsilylbenzo[f][2]benzofuran-4,9-dione |
| SMILES | COc1ccc(OC)c2c1C(=O)c1coc([Si](C)(C)C)c1C2=O |
| InChI | InChI=1S/C17H18O5Si/c1-20-10-6-7-11(21-2)14-13(10)15(18)9-8-22-17(23(3,4)5)12(9)16(14)19/h6-8H,1-5H3 |
| InChIKey | DEBWJGCIBDMLEG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|