C14H10O6 — CID 137276863
5,6-dihydroxy-7-methoxy-3-methylbenzo[f][2]benzofuran-4,9-dione (PubChem CID 137276863) has the molecular formula C14H10O6 and a molecular weight of 274.23 g/mol. Its IUPAC name is 5,6-dihydroxy-7-methoxy-3-methylbenzo[f][2]benzofuran-4,9-dione.
| Compound Name | 5,6-dihydroxy-7-methoxy-3-methylbenzo[f][2]benzofuran-4,9-dione |
|---|---|
| PubChem CID | 137276863 |
| Molecular Formula | C14H10O6 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 5,6-dihydroxy-7-methoxy-3-methylbenzo[f][2]benzofuran-4,9-dione |
| SMILES | COc1cc2c(c(O)c1O)C(=O)c1c(coc1C)C2=O |
| InChI | InChI=1S/C14H10O6/c1-5-9-7(4-20-5)11(15)6-3-8(19-2)12(16)14(18)10(6)13(9)17/h3-4,16,18H,1-2H3 |
| InChIKey | FEHALESAZWZNHA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|