C13H8O6 — CID 137276862
5,6,7-trihydroxy-3-methylbenzo[f][2]benzofuran-4,9-dione (PubChem CID 137276862) has the molecular formula C13H8O6 and a molecular weight of 260.20 g/mol. Its IUPAC name is 5,6,7-trihydroxy-3-methylbenzo[f][2]benzofuran-4,9-dione.
| Compound Name | 5,6,7-trihydroxy-3-methylbenzo[f][2]benzofuran-4,9-dione |
|---|---|
| PubChem CID | 137276862 |
| Molecular Formula | C13H8O6 |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 5,6,7-trihydroxy-3-methylbenzo[f][2]benzofuran-4,9-dione |
| SMILES | Cc1occ2c1C(=O)c1c(cc(O)c(O)c1O)C2=O |
| InChI | InChI=1S/C13H8O6/c1-4-8-6(3-19-4)10(15)5-2-7(14)11(16)13(18)9(5)12(8)17/h2-3,14,16,18H,1H3 |
| InChIKey | NHQJJIBBRBKQQZ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|