C20H16O8 — CID 163087354
3,7,8,9-tetrahydroxy-17-methyl-16,21-dioxapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),3,6,8,10,13-hexaene-5,12-dione (PubChem CID 163087354) has the molecular formula C20H16O8 and a molecular weight of 384.34 g/mol. Its IUPAC name is 3,7,8,9-tetrahydroxy-17-methyl-16,21-dioxapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),3,6,8,10,13-hexaene-5,12-dione.
| Compound Name | 3,7,8,9-tetrahydroxy-17-methyl-16,21-dioxapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),3,6,8,10,13-hexaene-5,12-dione |
|---|---|
| PubChem CID | 163087354 |
| Molecular Formula | C20H16O8 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 3,7,8,9-tetrahydroxy-17-methyl-16,21-dioxapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),3,6,8,10,13-hexaene-5,12-dione |
| SMILES | CC12CCCC(O1)c1c(cc3c(c1O)C(=O)c1c(cc(O)c(O)c1O)C3=O)O2 |
| InChI | InChI=1S/C20H16O8/c1-20-4-2-3-10(27-20)14-11(28-20)6-8-12(18(14)25)17(24)13-7(15(8)22)5-9(21)16(23)19(13)26/h5-6,10,21,23,25-26H,2-4H2,1H3 |
| InChIKey | FHAYEPCIFHTYLU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|