C20H16O7 — CID 162964621
(1R,17R)-3,7,9-trihydroxy-1-methyl-16,21-dioxapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),3,6(11),7,9,13-hexaene-5,12-dione (PubChem CID 162964621) has the molecular formula C20H16O7 and a molecular weight of 368.34 g/mol. Its IUPAC name is (1R,17R)-3,7,9-trihydroxy-1-methyl-16,21-dioxapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),3,6(11),7,9,13-hexaene-5,12-dione.
| Compound Name | (1R,17R)-3,7,9-trihydroxy-1-methyl-16,21-dioxapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),3,6(11),7,9,13-hexaene-5,12-dione |
|---|---|
| PubChem CID | 162964621 |
| Molecular Formula | C20H16O7 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | (1R,17R)-3,7,9-trihydroxy-1-methyl-16,21-dioxapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),3,6(11),7,9,13-hexaene-5,12-dione |
| SMILES | C[C@@]12CCC[C@@H](Oc3cc4c(c(O)c31)C(=O)c1c(O)cc(O)cc1C4=O)O2 |
| InChI | InChI=1S/C20H16O7/c1-20-4-2-3-13(27-20)26-12-7-10-15(19(25)16(12)20)18(24)14-9(17(10)23)5-8(21)6-11(14)22/h5-7,13,21-22,25H,2-4H2,1H3/t13-,20+/m0/s1 |
| InChIKey | WYMFAQZYKTWISK-RNODOKPDSA-N |
| XLogP | 2.71 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|