C21H18O8 — CID 163003889
3,9,20-trihydroxy-7-methoxy-17-methyl-16,21-dioxapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),3,6(11),7,9,13-hexaene-5,12-dione (PubChem CID 163003889) has the molecular formula C21H18O8 and a molecular weight of 398.37 g/mol. Its IUPAC name is 3,9,20-trihydroxy-7-methoxy-17-methyl-16,21-dioxapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),3,6(11),7,9,13-hexaene-5,12-dione.
| Compound Name | 3,9,20-trihydroxy-7-methoxy-17-methyl-16,21-dioxapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),3,6(11),7,9,13-hexaene-5,12-dione |
|---|---|
| PubChem CID | 163003889 |
| Molecular Formula | C21H18O8 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 3,9,20-trihydroxy-7-methoxy-17-methyl-16,21-dioxapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),3,6(11),7,9,13-hexaene-5,12-dione |
| SMILES | COc1cc(O)cc2c1C(=O)c1c(cc3c(c1O)C1OC(C)(CCC1O)O3)C2=O |
| InChI | InChI=1S/C21H18O8/c1-21-4-3-11(23)20(29-21)16-13(28-21)7-10-15(19(16)26)18(25)14-9(17(10)24)5-8(22)6-12(14)27-2/h5-7,11,20,22-23,26H,3-4H2,1-2H3 |
| InChIKey | RJWLVUKDQNSXEH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|