C18H14O8 — CID 10642118
2,4,5,7,9-pentahydroxy-2-methyl-3,4-dihydronaphtho[2,3-g]chromene-6,11-dione (PubChem CID 10642118) has the molecular formula C18H14O8 and a molecular weight of 358.30 g/mol. Its IUPAC name is 2,4,5,7,9-pentahydroxy-2-methyl-3,4-dihydronaphtho[2,3-g]chromene-6,11-dione.
| Compound Name | 2,4,5,7,9-pentahydroxy-2-methyl-3,4-dihydronaphtho[2,3-g]chromene-6,11-dione |
|---|---|
| PubChem CID | 10642118 |
| Molecular Formula | C18H14O8 |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 2,4,5,7,9-pentahydroxy-2-methyl-3,4-dihydronaphtho[2,3-g]chromene-6,11-dione |
| SMILES | CC1(O)CC(O)c2c(cc3c(c2O)C(=O)c2c(O)cc(O)cc2C3=O)O1 |
| InChI | InChI=1S/C18H14O8/c1-18(25)5-10(21)14-11(26-18)4-8-13(17(14)24)16(23)12-7(15(8)22)2-6(19)3-9(12)20/h2-4,10,19-21,24-25H,5H2,1H3 |
| InChIKey | BCYZJGHFTIQGMP-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|