C21H18O9 — CID 162849059
[2-(1,3,6,8-tetrahydroxy-9,10-dioxoanthracen-2-yl)oxan-4-yl] acetate (PubChem CID 162849059) has the molecular formula C21H18O9 and a molecular weight of 414.37 g/mol. Its IUPAC name is [2-(1,3,6,8-tetrahydroxy-9,10-dioxoanthracen-2-yl)oxan-4-yl] acetate.
| Compound Name | [2-(1,3,6,8-tetrahydroxy-9,10-dioxoanthracen-2-yl)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 162849059 |
| Molecular Formula | C21H18O9 |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | [2-(1,3,6,8-tetrahydroxy-9,10-dioxoanthracen-2-yl)oxan-4-yl] acetate |
| SMILES | CC(=O)OC1CCOC(c2c(O)cc3c(c2O)C(=O)c2c(O)cc(O)cc2C3=O)C1 |
| InChI | InChI=1S/C21H18O9/c1-8(22)30-10-2-3-29-15(6-10)18-14(25)7-12-17(21(18)28)20(27)16-11(19(12)26)4-9(23)5-13(16)24/h4-5,7,10,15,23-25,28H,2-3,6H2,1H3 |
| InChIKey | XQHGMVWEFXZCLR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|