C21H14O8 — CID 163024467
(1R)-2-ethyl-5,7,9-trihydroxy-4,6,11-trioxo-1H-tetracene-1-carboxylic acid (PubChem CID 163024467) has the molecular formula C21H14O8 and a molecular weight of 394.34 g/mol. Its IUPAC name is (1R)-2-ethyl-5,7,9-trihydroxy-4,6,11-trioxo-1H-tetracene-1-carboxylic acid.
| Compound Name | (1R)-2-ethyl-5,7,9-trihydroxy-4,6,11-trioxo-1H-tetracene-1-carboxylic acid |
|---|---|
| PubChem CID | 163024467 |
| Molecular Formula | C21H14O8 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | (1R)-2-ethyl-5,7,9-trihydroxy-4,6,11-trioxo-1H-tetracene-1-carboxylic acid |
| SMILES | CCC1=CC(=O)c2c(cc3c(c2O)C(=O)c2c(O)cc(O)cc2C3=O)[C@@H]1C(=O)O |
| InChI | InChI=1S/C21H14O8/c1-2-7-3-12(23)15-9(14(7)21(28)29)6-11-17(19(15)26)20(27)16-10(18(11)25)4-8(22)5-13(16)24/h3-6,14,22,24,26H,2H2,1H3,(H,28,29)/t14-/m1/s1 |
| InChIKey | SGWZPKSIDOPHHL-CQSZACIVSA-N |
| XLogP | 2.28 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'} |
|---|