C23H20O6 — CID 23260671
methyl 2-ethyl-5-hydroxy-7-methoxy-6,11-dioxo-1,4-dihydrotetracene-1-carboxylate (PubChem CID 23260671) has the molecular formula C23H20O6 and a molecular weight of 392.41 g/mol. Its IUPAC name is methyl 2-ethyl-5-hydroxy-7-methoxy-6,11-dioxo-1,4-dihydrotetracene-1-carboxylate.
| Compound Name | methyl 2-ethyl-5-hydroxy-7-methoxy-6,11-dioxo-1,4-dihydrotetracene-1-carboxylate |
|---|---|
| PubChem CID | 23260671 |
| Molecular Formula | C23H20O6 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | methyl 2-ethyl-5-hydroxy-7-methoxy-6,11-dioxo-1,4-dihydrotetracene-1-carboxylate |
| SMILES | CCC1=CCc2c(cc3c(c2O)C(=O)c2c(OC)cccc2C3=O)C1C(=O)OC |
| InChI | InChI=1S/C23H20O6/c1-4-11-8-9-12-14(17(11)23(27)29-3)10-15-19(21(12)25)22(26)18-13(20(15)24)6-5-7-16(18)28-2/h5-8,10,17,25H,4,9H2,1-3H3 |
| InChIKey | NCIXSQKVSHUOEK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|