C25H27NO5Si — CID 13224429
2-ethyl-5-hydroxy-7-methoxy-6,11-dioxo-1-trimethylsilyloxy-3,4-dihydro-2H-tetracene-1-carbonitrile (PubChem CID 13224429) has the molecular formula C25H27NO5Si and a molecular weight of 449.58 g/mol. Its IUPAC name is 2-ethyl-5-hydroxy-7-methoxy-6,11-dioxo-1-trimethylsilyloxy-3,4-dihydro-2H-tetracene-1-carbonitrile.
| Compound Name | 2-ethyl-5-hydroxy-7-methoxy-6,11-dioxo-1-trimethylsilyloxy-3,4-dihydro-2H-tetracene-1-carbonitrile |
|---|---|
| PubChem CID | 13224429 |
| Molecular Formula | C25H27NO5Si |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 2-ethyl-5-hydroxy-7-methoxy-6,11-dioxo-1-trimethylsilyloxy-3,4-dihydro-2H-tetracene-1-carbonitrile |
| SMILES | CCC1CCc2c(cc3c(c2O)C(=O)c2c(OC)cccc2C3=O)C1(C#N)O[Si](C)(C)C |
| InChI | InChI=1S/C25H27NO5Si/c1-6-14-10-11-15-18(25(14,13-26)31-32(3,4)5)12-17-21(23(15)28)24(29)20-16(22(17)27)8-7-9-19(20)30-2/h7-9,12,14,28H,6,10-11H2,1-5H3 |
| InChIKey | PLRRKONRELUEQB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|