C21H20O8 — CID 38359725
(1R,17R)-3,8-dihydroxy-7,14-dimethoxy-17-methyl-12,16,21-trioxapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),3,6(11),7,9,13-hexaen-5-one (PubChem CID 38359725) has the molecular formula C21H20O8 and a molecular weight of 400.38 g/mol. Its IUPAC name is (1R,17R)-3,8-dihydroxy-7,14-dimethoxy-17-methyl-12,16,21-trioxapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),3,6(11),7,9,13-hexaen-5-one.
| Compound Name | (1R,17R)-3,8-dihydroxy-7,14-dimethoxy-17-methyl-12,16,21-trioxapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),3,6(11),7,9,13-hexaen-5-one |
|---|---|
| PubChem CID | 38359725 |
| Molecular Formula | C21H20O8 |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | (1R,17R)-3,8-dihydroxy-7,14-dimethoxy-17-methyl-12,16,21-trioxapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),3,6(11),7,9,13-hexaen-5-one |
| SMILES | COc1c2c(c(O)c3c(=O)c4c(OC)c(O)ccc4oc13)[C@H]1CCC[C@@](C)(O2)O1 |
| InChI | InChI=1S/C21H20O8/c1-21-8-4-5-11(28-21)13-16(24)14-15(23)12-10(7-6-9(22)17(12)25-2)27-18(14)20(26-3)19(13)29-21/h6-7,11,22,24H,4-5,8H2,1-3H3/t11-,21-/m1/s1 |
| InChIKey | MTCOVRSZCNNQLP-WSVYEEACSA-N |
| XLogP | 3.72 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|