C28H24O11 — CID 102470958
(12S,13S)-3,12,13,21,22,26-hexahydroxy-15-methoxy-7-propyl-6,17-dioxahexacyclo[12.12.0.02,11.04,9.016,25.018,23]hexacosa-1(14),2(11),3,9,15,18(23),19,21,25-nonaene-5,24-dione (PubChem CID 102470958) has the molecular formula C28H24O11 and a molecular weight of 536.49 g/mol. Its IUPAC name is (12S,13S)-3,12,13,21,22,26-hexahydroxy-15-methoxy-7-propyl-6,17-dioxahexacyclo[12.12.0.02,11.04,9.016,25.018,23]hexacosa-1(14),2(11),3,9,15,18(23),19,21,25-nonaene-5,24-dione.
| Compound Name | (12S,13S)-3,12,13,21,22,26-hexahydroxy-15-methoxy-7-propyl-6,17-dioxahexacyclo[12.12.0.02,11.04,9.016,25.018,23]hexacosa-1(14),2(11),3,9,15,18(23),19,21,25-nonaene-5,24-dione |
|---|---|
| PubChem CID | 102470958 |
| Molecular Formula | C28H24O11 |
| Molecular Weight | 536.49 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | (12S,13S)-3,12,13,21,22,26-hexahydroxy-15-methoxy-7-propyl-6,17-dioxahexacyclo[12.12.0.02,11.04,9.016,25.018,23]hexacosa-1(14),2(11),3,9,15,18(23),19,21,25-nonaene-5,24-dione |
| SMILES | CCCC1Cc2cc3c(c(O)c2C(=O)O1)-c1c(c(OC)c2oc4ccc(O)c(O)c4c(=O)c2c1O)[C@H](O)[C@H]3O |
| InChI | InChI=1S/C28H24O11/c1-3-4-10-7-9-8-11-15(22(32)14(9)28(36)38-10)17-18(25(35)20(11)30)26(37-2)27-19(24(17)34)23(33)16-13(39-27)6-5-12(29)21(16)31/h5-6,8,10,20,25,29-32,34-35H,3-4,7H2,1-2H3/t10?,20-,25-/m0/s1 |
| InChIKey | RBJJDEUAQRKCOH-AJMFVKTASA-N |
| XLogP | 3.41 |
| TPSA | 187.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|