C16H16O8 — CID 139074495
1,7-dihydroxy-2,3,4-trimethoxyxanthen-9-one;hydrate (PubChem CID 139074495) has the molecular formula C16H16O8 and a molecular weight of 336.30 g/mol. Its IUPAC name is 1,7-dihydroxy-2,3,4-trimethoxyxanthen-9-one;hydrate.
| Compound Name | 1,7-dihydroxy-2,3,4-trimethoxyxanthen-9-one;hydrate |
|---|---|
| PubChem CID | 139074495 |
| Molecular Formula | C16H16O8 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 1,7-dihydroxy-2,3,4-trimethoxyxanthen-9-one;hydrate |
| SMILES | COc1c(OC)c(O)c2c(=O)c3cc(O)ccc3oc2c1OC.O |
| InChI | InChI=1S/C16H14O7.H2O/c1-20-14-12(19)10-11(18)8-6-7(17)4-5-9(8)23-13(10)15(21-2)16(14)22-3;/h4-6,17,19H,1-3H3;1H2 |
| InChIKey | GBRBGWLJUJCPIA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 129.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|