About 2-(3,3-dimethylpentyl)-1,7-dihydroxy-3-methoxyxanthen-9-one
2-(3,3-dimethylpentyl)-1,7-dihydroxy-3-methoxyxanthen-9-one (PubChem CID 69439479) has the molecular formula C21H24O5
and a molecular weight of 356.42 g/mol. Its IUPAC name is 2-(3,3-dimethylpentyl)-1,7-dihydroxy-3-methoxyxanthen-9-one.
Molecular Properties
| Compound Name | 2-(3,3-dimethylpentyl)-1,7-dihydroxy-3-methoxyxanthen-9-one |
| PubChem CID | 69439479 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 2-(3,3-dimethylpentyl)-1,7-dihydroxy-3-methoxyxanthen-9-one |
| SMILES | CCC(C)(C)CCc1c(OC)cc2oc3ccc(O)cc3c(=O)c2c1O |
| InChI | InChI=1S/C21H24O5/c1-5-21(2,3)9-8-13-16(25-4)11-17-18(19(13)23)20(24)14-10-12(22)6-7-15(14)26-17/h6-7,10-11,22-23H,5,8-9H2,1-4H3 |
| InChIKey | SVFWLNXXYNXEGH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,3-dimethylpentyl)-1,7-dihydroxy-3-methoxyxanthen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-dimethylpentyl)-1,7-dihydroxy-3-methoxyxanthen-9-one?
The IUPAC name of 2-(3,3-dimethylpentyl)-1,7-dihydroxy-3-methoxyxanthen-9-one (CID 69439479) is 2-(3,3-dimethylpentyl)-1,7-dihydroxy-3-methoxyxanthen-9-one.
What is the SMILES notation for 2-(3,3-dimethylpentyl)-1,7-dihydroxy-3-methoxyxanthen-9-one?
The canonical SMILES for 2-(3,3-dimethylpentyl)-1,7-dihydroxy-3-methoxyxanthen-9-one is CCC(C)(C)CCc1c(OC)cc2oc3ccc(O)cc3c(=O)c2c1O.
What is the InChIKey of 2-(3,3-dimethylpentyl)-1,7-dihydroxy-3-methoxyxanthen-9-one?
The InChIKey is SVFWLNXXYNXEGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24O5/c1-5-21(2,3)9-8-13-16(25-4)11-17-18(19(13)23)20(24)14-10-12(22)6-7-15(14)26-17/h6-7,10-11,22-23H,5,8-9H2,1-4H3.
What are the key properties of 2-(3,3-dimethylpentyl)-1,7-dihydroxy-3-methoxyxanthen-9-one?
2-(3,3-dimethylpentyl)-1,7-dihydroxy-3-methoxyxanthen-9-one has a molecular weight of 356.42 g/mol, XLogP of 4.73, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-dimethylpentyl)-1,7-dihydroxy-3-methoxyxanthen-9-one is sourced from PubChem (CID 69439479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).