C22H24O6 — CID 132543867
2-hydroxy-7,8-dimethoxy-3-methyl-1-(2-methylbut-3-en-2-yloxymethyl)xanthen-9-one (PubChem CID 132543867) has the molecular formula C22H24O6 and a molecular weight of 384.43 g/mol. Its IUPAC name is 2-hydroxy-7,8-dimethoxy-3-methyl-1-(2-methylbut-3-en-2-yloxymethyl)xanthen-9-one.
| Compound Name | 2-hydroxy-7,8-dimethoxy-3-methyl-1-(2-methylbut-3-en-2-yloxymethyl)xanthen-9-one |
|---|---|
| PubChem CID | 132543867 |
| Molecular Formula | C22H24O6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 2-hydroxy-7,8-dimethoxy-3-methyl-1-(2-methylbut-3-en-2-yloxymethyl)xanthen-9-one |
| SMILES | C=CC(C)(C)OCc1c(O)c(C)cc2oc3ccc(OC)c(OC)c3c(=O)c12 |
| InChI | InChI=1S/C22H24O6/c1-7-22(3,4)27-11-13-17-16(10-12(2)19(13)23)28-14-8-9-15(25-5)21(26-6)18(14)20(17)24/h7-10,23H,1,11H2,2-6H3 |
| InChIKey | REPXYLYPEUTIIE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|