C20H18O5 — CID 123677692
7-hydroxy-2-(4-hydroxyphenyl)-5-methoxy-6-methyl-3-prop-2-enylchromen-4-one (PubChem CID 123677692) has the molecular formula C20H18O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is 7-hydroxy-2-(4-hydroxyphenyl)-5-methoxy-6-methyl-3-prop-2-enylchromen-4-one.
| Compound Name | 7-hydroxy-2-(4-hydroxyphenyl)-5-methoxy-6-methyl-3-prop-2-enylchromen-4-one |
|---|---|
| PubChem CID | 123677692 |
| Molecular Formula | C20H18O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 7-hydroxy-2-(4-hydroxyphenyl)-5-methoxy-6-methyl-3-prop-2-enylchromen-4-one |
| SMILES | C=CCc1c(-c2ccc(O)cc2)oc2cc(O)c(C)c(OC)c2c1=O |
| InChI | InChI=1S/C20H18O5/c1-4-5-14-18(23)17-16(10-15(22)11(2)19(17)24-3)25-20(14)12-6-8-13(21)9-7-12/h4,6-10,21-22H,1,5H2,2-3H3 |
| InChIKey | SOVPTKJIUUUIJJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|