C21H18O2 — CID 141233837
2-phenyl-3,5-bis(prop-2-enyl)chromen-4-one (PubChem CID 141233837) has the molecular formula C21H18O2 and a molecular weight of 302.37 g/mol. Its IUPAC name is 2-phenyl-3,5-bis(prop-2-enyl)chromen-4-one.
| Compound Name | 2-phenyl-3,5-bis(prop-2-enyl)chromen-4-one |
|---|---|
| PubChem CID | 141233837 |
| Molecular Formula | C21H18O2 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 2-phenyl-3,5-bis(prop-2-enyl)chromen-4-one |
| SMILES | C=CCc1c(-c2ccccc2)oc2cccc(CC=C)c2c1=O |
| InChI | InChI=1S/C21H18O2/c1-3-9-15-13-8-14-18-19(15)20(22)17(10-4-2)21(23-18)16-11-6-5-7-12-16/h3-8,11-14H,1-2,9-10H2 |
| InChIKey | URONYBDFJAQMLB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|