C18H12F2O2 — CID 54442447
2-(3,5-difluorophenyl)-3-prop-2-enylchromen-4-one (PubChem CID 54442447) has the molecular formula C18H12F2O2 and a molecular weight of 298.29 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-3-prop-2-enylchromen-4-one.
| Compound Name | 2-(3,5-difluorophenyl)-3-prop-2-enylchromen-4-one |
|---|---|
| PubChem CID | 54442447 |
| Molecular Formula | C18H12F2O2 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 2-(3,5-difluorophenyl)-3-prop-2-enylchromen-4-one |
| SMILES | C=CCc1c(-c2cc(F)cc(F)c2)oc2ccccc2c1=O |
| InChI | InChI=1S/C18H12F2O2/c1-2-5-15-17(21)14-6-3-4-7-16(14)22-18(15)11-8-12(19)10-13(20)9-11/h2-4,6-10H,1,5H2 |
| InChIKey | WPBZBDANCORDKH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|