About 3-fluoro-2-(3,4,5-trihydroxyphenyl)chromen-4-one
3-fluoro-2-(3,4,5-trihydroxyphenyl)chromen-4-one (PubChem CID 162653629) has the molecular formula C15H9FO5
and a molecular weight of 288.23 g/mol. Its IUPAC name is 3-fluoro-2-(3,4,5-trihydroxyphenyl)chromen-4-one.
Molecular Properties
| Compound Name | 3-fluoro-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
| PubChem CID | 162653629 |
| Molecular Formula | C15H9FO5 |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 3-fluoro-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
| SMILES | O=c1c(F)c(-c2cc(O)c(O)c(O)c2)oc2ccccc12 |
| InChI | InChI=1S/C15H9FO5/c16-12-13(19)8-3-1-2-4-11(8)21-15(12)7-5-9(17)14(20)10(18)6-7/h1-6,17-18,20H |
| InChIKey | BEGAPHOLHQXKCJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-2-(3,4,5-trihydroxyphenyl)chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-2-(3,4,5-trihydroxyphenyl)chromen-4-one?
The IUPAC name of 3-fluoro-2-(3,4,5-trihydroxyphenyl)chromen-4-one (CID 162653629) is 3-fluoro-2-(3,4,5-trihydroxyphenyl)chromen-4-one.
What is the SMILES notation for 3-fluoro-2-(3,4,5-trihydroxyphenyl)chromen-4-one?
The canonical SMILES for 3-fluoro-2-(3,4,5-trihydroxyphenyl)chromen-4-one is O=c1c(F)c(-c2cc(O)c(O)c(O)c2)oc2ccccc12.
What is the InChIKey of 3-fluoro-2-(3,4,5-trihydroxyphenyl)chromen-4-one?
The InChIKey is BEGAPHOLHQXKCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9FO5/c16-12-13(19)8-3-1-2-4-11(8)21-15(12)7-5-9(17)14(20)10(18)6-7/h1-6,17-18,20H.
What are the key properties of 3-fluoro-2-(3,4,5-trihydroxyphenyl)chromen-4-one?
3-fluoro-2-(3,4,5-trihydroxyphenyl)chromen-4-one has a molecular weight of 288.23 g/mol, XLogP of 2.72, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-2-(3,4,5-trihydroxyphenyl)chromen-4-one is sourced from PubChem (CID 162653629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).