C10H8O3 — CID 140551297
4-prop-2-enyl-1,3-benzodioxol-2-one (PubChem CID 140551297) has the molecular formula C10H8O3 and a molecular weight of 176.17 g/mol. Its IUPAC name is 4-prop-2-enyl-1,3-benzodioxol-2-one.
| Compound Name | 4-prop-2-enyl-1,3-benzodioxol-2-one |
|---|---|
| PubChem CID | 140551297 |
| Molecular Formula | C10H8O3 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | 4-prop-2-enyl-1,3-benzodioxol-2-one |
| SMILES | C=CCc1cccc2oc(=O)oc12 |
| InChI | InChI=1S/C10H8O3/c1-2-4-7-5-3-6-8-9(7)13-10(11)12-8/h2-3,5-6H,1,4H2 |
| InChIKey | PCWCXISSNGBOIS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|