C18H16O8 — CID 91587475
7-hydroxy-3-(4-hydroxyphenyl)-2,6-dimethoxy-5-methylperoxychromen-4-one (PubChem CID 91587475) has the molecular formula C18H16O8 and a molecular weight of 360.32 g/mol. Its IUPAC name is 7-hydroxy-3-(4-hydroxyphenyl)-2,6-dimethoxy-5-methylperoxychromen-4-one.
| Compound Name | 7-hydroxy-3-(4-hydroxyphenyl)-2,6-dimethoxy-5-methylperoxychromen-4-one |
|---|---|
| PubChem CID | 91587475 |
| Molecular Formula | C18H16O8 |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 7-hydroxy-3-(4-hydroxyphenyl)-2,6-dimethoxy-5-methylperoxychromen-4-one |
| SMILES | COOc1c(OC)c(O)cc2oc(OC)c(-c3ccc(O)cc3)c(=O)c12 |
| InChI | InChI=1S/C18H16O8/c1-22-16-11(20)8-12-14(17(16)26-24-3)15(21)13(18(23-2)25-12)9-4-6-10(19)7-5-9/h4-8,19-20H,1-3H3 |
| InChIKey | VOYKBWNQWZBKJH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|