C17H14O8 — CID 162971212
3-(3,4-dihydroxyphenyl)-7,8-dihydroxy-2,6-dimethoxychromen-4-one (PubChem CID 162971212) has the molecular formula C17H14O8 and a molecular weight of 346.29 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-7,8-dihydroxy-2,6-dimethoxychromen-4-one.
| Compound Name | 3-(3,4-dihydroxyphenyl)-7,8-dihydroxy-2,6-dimethoxychromen-4-one |
|---|---|
| PubChem CID | 162971212 |
| Molecular Formula | C17H14O8 |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-7,8-dihydroxy-2,6-dimethoxychromen-4-one |
| SMILES | COc1cc2c(=O)c(-c3ccc(O)c(O)c3)c(OC)oc2c(O)c1O |
| InChI | InChI=1S/C17H14O8/c1-23-11-6-8-13(20)12(7-3-4-9(18)10(19)5-7)17(24-2)25-16(8)15(22)14(11)21/h3-6,18-19,21-22H,1-2H3 |
| InChIKey | FBAZEVPUSBTMRN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 129.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|