C24H24O6 — CID 25116816
2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-3-[(2E)-5-methylhexa-2,4-dienyl]chromen-4-one (PubChem CID 25116816) has the molecular formula C24H24O6 and a molecular weight of 408.45 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-3-[(2E)-5-methylhexa-2,4-dienyl]chromen-4-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-3-[(2E)-5-methylhexa-2,4-dienyl]chromen-4-one |
|---|---|
| PubChem CID | 25116816 |
| Molecular Formula | C24H24O6 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-3-[(2E)-5-methylhexa-2,4-dienyl]chromen-4-one |
| SMILES | COc1ccc(-c2oc3cc(O)cc(O)c3c(=O)c2C/C=C/C=C(C)C)cc1OC |
| InChI | InChI=1S/C24H24O6/c1-14(2)7-5-6-8-17-23(27)22-18(26)12-16(25)13-21(22)30-24(17)15-9-10-19(28-3)20(11-15)29-4/h5-7,9-13,25-26H,8H2,1-4H3/b6-5+ |
| InChIKey | AIYISWKGFLCYHC-AATRIKPKSA-N |
| XLogP | 4.95 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|