C23H22O6S — CID 25116116
[5-hydroxy-3-[(2E)-5-methylhexa-2,4-dienyl]-4-oxo-2-phenylchromen-7-yl] methanesulfonate (PubChem CID 25116116) has the molecular formula C23H22O6S and a molecular weight of 426.49 g/mol. Its IUPAC name is [5-hydroxy-3-[(2E)-5-methylhexa-2,4-dienyl]-4-oxo-2-phenylchromen-7-yl] methanesulfonate.
| Compound Name | [5-hydroxy-3-[(2E)-5-methylhexa-2,4-dienyl]-4-oxo-2-phenylchromen-7-yl] methanesulfonate |
|---|---|
| PubChem CID | 25116116 |
| Molecular Formula | C23H22O6S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | [5-hydroxy-3-[(2E)-5-methylhexa-2,4-dienyl]-4-oxo-2-phenylchromen-7-yl] methanesulfonate |
| SMILES | CC(C)=C/C=C/Cc1c(-c2ccccc2)oc2cc(OS(C)(=O)=O)cc(O)c2c1=O |
| InChI | InChI=1S/C23H22O6S/c1-15(2)9-7-8-12-18-22(25)21-19(24)13-17(29-30(3,26)27)14-20(21)28-23(18)16-10-5-4-6-11-16/h4-11,13-14,24H,12H2,1-3H3/b8-7+ |
| InChIKey | RKLGPSVRCHTCPJ-BQYQJAHWSA-N |
| XLogP | 4.57 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|